About 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile
4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile (PubChem CID 166638263) has the molecular formula C34H22N4
and a molecular weight of 486.58 g/mol. Its IUPAC name is 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile |
| PubChem CID | 166638263 |
| Molecular Formula | C34H22N4 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(N=C(c2ccccc2)c2ccccc2)c(N=C(c2ccccc2)c2ccccc2)cc1C#N |
| InChI | InChI=1S/C34H22N4/c35-23-29-21-31(37-33(25-13-5-1-6-14-25)26-15-7-2-8-16-26)32(22-30(29)24-36)38-34(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-22H |
| InChIKey | XBUJJLIIKFUJJX-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile?
The IUPAC name of 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile (CID 166638263) is 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile is N#Cc1cc(N=C(c2ccccc2)c2ccccc2)c(N=C(c2ccccc2)c2ccccc2)cc1C#N.
What is the InChIKey of 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile?
The InChIKey is XBUJJLIIKFUJJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H22N4/c35-23-29-21-31(37-33(25-13-5-1-6-14-25)26-15-7-2-8-16-26)32(22-30(29)24-36)38-34(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-22H.
What are the key properties of 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile?
4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile has a molecular weight of 486.58 g/mol, XLogP of 7.77, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(benzhydrylideneamino)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 166638263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).