C26H18F3N3O2 — CID 171820183
methyl 5-(benzhydrylideneamino)-3-cyano-1-(2,2,2-trifluoroethyl)indole-6-carboxylate (PubChem CID 171820183) has the molecular formula C26H18F3N3O2 and a molecular weight of 461.44 g/mol. Its IUPAC name is methyl 5-(benzhydrylideneamino)-3-cyano-1-(2,2,2-trifluoroethyl)indole-6-carboxylate.
| Compound Name | methyl 5-(benzhydrylideneamino)-3-cyano-1-(2,2,2-trifluoroethyl)indole-6-carboxylate |
|---|---|
| PubChem CID | 171820183 |
| Molecular Formula | C26H18F3N3O2 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | methyl 5-(benzhydrylideneamino)-3-cyano-1-(2,2,2-trifluoroethyl)indole-6-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1N=C(c1ccccc1)c1ccccc1)c(C#N)cn2CC(F)(F)F |
| InChI | InChI=1S/C26H18F3N3O2/c1-34-25(33)21-13-23-20(19(14-30)15-32(23)16-26(27,28)29)12-22(21)31-24(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-13,15H,16H2,1H3 |
| InChIKey | GWJIYQNONGXBRQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 67.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|