methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate

C12H9BrF3NO2 — CID 154814756

IUPACmethyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)c(Br)cn2CC(F)(F)F
InChIInChI=1S/C12H9BrF3NO2/c1-19-11(18)7-2-3-10-8(4-7)9(13)5-17(10)6-12(14,15)16/h2-5H,6H2,1H3
InChIKeyGUFYQOIXTCKJND-UHFFFAOYSA-N
MW336.11 g/mol
LogP3.75
Rot. Bonds2

About methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate

methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate (PubChem CID 154814756) has the molecular formula C12H9BrF3NO2 and a molecular weight of 336.11 g/mol. Its IUPAC name is methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate.

Molecular Properties

Compound Namemethyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate
PubChem CID154814756
Molecular FormulaC12H9BrF3NO2
Molecular Weight336.11 g/mol
Exact Mass334.98
IUPAC Namemethyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)c(Br)cn2CC(F)(F)F
InChIInChI=1S/C12H9BrF3NO2/c1-19-11(18)7-2-3-10-8(4-7)9(13)5-17(10)6-12(14,15)16/h2-5H,6H2,1H3
InChIKeyGUFYQOIXTCKJND-UHFFFAOYSA-N
XLogP3.75
TPSA31.23 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500336.11
LogP ≤ 53.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate?
The IUPAC name of methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate (CID 154814756) is methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate.
What is the SMILES notation for methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate?
The canonical SMILES for methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate is COC(=O)c1ccc2c(c1)c(Br)cn2CC(F)(F)F.
What is the InChIKey of methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate?
The InChIKey is GUFYQOIXTCKJND-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrF3NO2/c1-19-11(18)7-2-3-10-8(4-7)9(13)5-17(10)6-12(14,15)16/h2-5H,6H2,1H3.
What are the key properties of methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate?
methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate has a molecular weight of 336.11 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate is sourced from PubChem (CID 154814756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).