C12H9BrF3NO2 — CID 154814756
methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate (PubChem CID 154814756) has the molecular formula C12H9BrF3NO2 and a molecular weight of 336.11 g/mol. Its IUPAC name is methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate.
| Compound Name | methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate |
|---|---|
| PubChem CID | 154814756 |
| Molecular Formula | C12H9BrF3NO2 |
| Molecular Weight | 336.11 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | methyl 3-bromo-1-(2,2,2-trifluoroethyl)indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c(Br)cn2CC(F)(F)F |
| InChI | InChI=1S/C12H9BrF3NO2/c1-19-11(18)7-2-3-10-8(4-7)9(13)5-17(10)6-12(14,15)16/h2-5H,6H2,1H3 |
| InChIKey | GUFYQOIXTCKJND-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.11 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |