methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate

C14H16N2O4 — CID 118658750

IUPACmethyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate
SMILESCCn1c(=O)c2cc(C(=O)OC)ccc2n(CC)c1=O
InChIInChI=1S/C14H16N2O4/c1-4-15-11-7-6-9(13(18)20-3)8-10(11)12(17)16(5-2)14(15)19/h6-8H,4-5H2,1-3H3
InChIKeyFXWARIRTGFKMOC-UHFFFAOYSA-N
MW276.29 g/mol
LogP0.99
Rot. Bonds3

About methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate

methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate (PubChem CID 118658750) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate.

Molecular Properties

Compound Namemethyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate
PubChem CID118658750
Molecular FormulaC14H16N2O4
Molecular Weight276.29 g/mol
Exact Mass276.11
IUPAC Namemethyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate
SMILESCCn1c(=O)c2cc(C(=O)OC)ccc2n(CC)c1=O
InChIInChI=1S/C14H16N2O4/c1-4-15-11-7-6-9(13(18)20-3)8-10(11)12(17)16(5-2)14(15)19/h6-8H,4-5H2,1-3H3
InChIKeyFXWARIRTGFKMOC-UHFFFAOYSA-N
XLogP0.99
TPSA70.30 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.29
LogP ≤ 50.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate?
The IUPAC name of methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate (CID 118658750) is methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate.
What is the SMILES notation for methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate?
The canonical SMILES for methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate is CCn1c(=O)c2cc(C(=O)OC)ccc2n(CC)c1=O.
What is the InChIKey of methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate?
The InChIKey is FXWARIRTGFKMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4/c1-4-15-11-7-6-9(13(18)20-3)8-10(11)12(17)16(5-2)14(15)19/h6-8H,4-5H2,1-3H3.
What are the key properties of methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate?
methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate has a molecular weight of 276.29 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,3-diethyl-2,4-dioxoquinazoline-6-carboxylate is sourced from PubChem (CID 118658750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).