About methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate
methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate (PubChem CID 68883697) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate |
| PubChem CID | 68883697 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate |
| SMILES | CCn1c2c(c3cc(C(=O)OC)ccc31)CC(C)(C)CC2 |
| InChI | InChI=1S/C18H23NO2/c1-5-19-15-7-6-12(17(20)21-4)10-13(15)14-11-18(2,3)9-8-16(14)19/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | XUKMXKQKQXJCPD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate?
The IUPAC name of methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate (CID 68883697) is methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate.
What is the SMILES notation for methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate?
The canonical SMILES for methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate is CCn1c2c(c3cc(C(=O)OC)ccc31)CC(C)(C)CC2.
What is the InChIKey of methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate?
The InChIKey is XUKMXKQKQXJCPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO2/c1-5-19-15-7-6-12(17(20)21-4)10-13(15)14-11-18(2,3)9-8-16(14)19/h6-7,10H,5,8-9,11H2,1-4H3.
What are the key properties of methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate?
methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate has a molecular weight of 285.39 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-ethyl-6,6-dimethyl-7,8-dihydro-5H-carbazole-3-carboxylate is sourced from PubChem (CID 68883697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).