C22H21F2NO3 — CID 177149426
methyl 6,6-difluoro-9-(2-phenoxyethyl)-7,8-dihydro-5H-carbazole-3-carboxylate (PubChem CID 177149426) has the molecular formula C22H21F2NO3 and a molecular weight of 385.41 g/mol. Its IUPAC name is methyl 6,6-difluoro-9-(2-phenoxyethyl)-7,8-dihydro-5H-carbazole-3-carboxylate.
| Compound Name | methyl 6,6-difluoro-9-(2-phenoxyethyl)-7,8-dihydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 177149426 |
| Molecular Formula | C22H21F2NO3 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | methyl 6,6-difluoro-9-(2-phenoxyethyl)-7,8-dihydro-5H-carbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCOc2ccccc2)CCC(F)(F)C1 |
| InChI | InChI=1S/C22H21F2NO3/c1-27-21(26)15-7-8-19-17(13-15)18-14-22(23,24)10-9-20(18)25(19)11-12-28-16-5-3-2-4-6-16/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | GXZCMHQSDBNUTD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|