C16H19N3O3 — CID 118658180
(E)-N-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)but-2-enamide (PubChem CID 118658180) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (E)-N-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)but-2-enamide.
| Compound Name | (E)-N-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)but-2-enamide |
|---|---|
| PubChem CID | 118658180 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (E)-N-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccc2c(c1)c(=O)n(CC)c(=O)n2CC |
| InChI | InChI=1S/C16H19N3O3/c1-4-7-14(20)17-11-8-9-13-12(10-11)15(21)19(6-3)16(22)18(13)5-2/h4,7-10H,5-6H2,1-3H3,(H,17,20)/b7-4+ |
| InChIKey | BQOWVOQCTOQGOL-QPJJXVBHSA-N |
| XLogP | 1.72 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|