C22H26N4O3 — CID 118658550
4-amino-N-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)-3-phenylbutanamide (PubChem CID 118658550) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-amino-N-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)-3-phenylbutanamide.
| Compound Name | 4-amino-N-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)-3-phenylbutanamide |
|---|---|
| PubChem CID | 118658550 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-amino-N-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)-3-phenylbutanamide |
| SMILES | CCn1c(=O)c2cc(NC(=O)CC(CN)c3ccccc3)ccc2n(CC)c1=O |
| InChI | InChI=1S/C22H26N4O3/c1-3-25-19-11-10-17(13-18(19)21(28)26(4-2)22(25)29)24-20(27)12-16(14-23)15-8-6-5-7-9-15/h5-11,13,16H,3-4,12,14,23H2,1-2H3,(H,24,27) |
| InChIKey | IQDDCCUYFSEFCY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |