C22H22ClN5O4 — CID 55661931
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetamide (PubChem CID 55661931) has the molecular formula C22H22ClN5O4 and a molecular weight of 455.90 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetamide |
|---|---|
| PubChem CID | 55661931 |
| Molecular Formula | C22H22ClN5O4 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetamide |
| SMILES | CCn1c(=O)c2ccccc2n(CC(=O)Nc2ccc(N3CCNC(=O)C3)c(Cl)c2)c1=O |
| InChI | InChI=1S/C22H22ClN5O4/c1-2-27-21(31)15-5-3-4-6-17(15)28(22(27)32)13-20(30)25-14-7-8-18(16(23)11-14)26-10-9-24-19(29)12-26/h3-8,11H,2,9-10,12-13H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | ZPIXDWLSQPQYIN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|