About 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile
2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile (PubChem CID 154468806) has the molecular formula C19H18ClN5O2
and a molecular weight of 383.84 g/mol. Its IUPAC name is 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile.
Molecular Properties
| Compound Name | 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile |
| PubChem CID | 154468806 |
| Molecular Formula | C19H18ClN5O2 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile |
| SMILES | CCn1c(=O)c2cc(NNc3ccc(C#N)c(Cl)c3)ccc2n(CC)c1=O |
| InChI | InChI=1S/C19H18ClN5O2/c1-3-24-17-8-7-13(9-15(17)18(26)25(4-2)19(24)27)22-23-14-6-5-12(11-21)16(20)10-14/h5-10,22-23H,3-4H2,1-2H3 |
| InChIKey | RPZOXQQCNHUPDT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile?
The IUPAC name of 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile (CID 154468806) is 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile.
What is the SMILES notation for 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile?
The canonical SMILES for 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile is CCn1c(=O)c2cc(NNc3ccc(C#N)c(Cl)c3)ccc2n(CC)c1=O.
What is the InChIKey of 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile?
The InChIKey is RPZOXQQCNHUPDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN5O2/c1-3-24-17-8-7-13(9-15(17)18(26)25(4-2)19(24)27)22-23-14-6-5-12(11-21)16(20)10-14/h5-10,22-23H,3-4H2,1-2H3.
What are the key properties of 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile?
2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile has a molecular weight of 383.84 g/mol, XLogP of 3.17, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[2-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)hydrazinyl]benzonitrile is sourced from PubChem (CID 154468806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).