C24H24ClN3O4 — CID 147334687
2-chloro-4-[5-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)-4-oxopentoxy]benzonitrile (PubChem CID 147334687) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is 2-chloro-4-[5-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)-4-oxopentoxy]benzonitrile.
| Compound Name | 2-chloro-4-[5-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)-4-oxopentoxy]benzonitrile |
|---|---|
| PubChem CID | 147334687 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-chloro-4-[5-(1,3-diethyl-2,4-dioxoquinazolin-6-yl)-4-oxopentoxy]benzonitrile |
| SMILES | CCn1c(=O)c2cc(CC(=O)CCCOc3ccc(C#N)c(Cl)c3)ccc2n(CC)c1=O |
| InChI | InChI=1S/C24H24ClN3O4/c1-3-27-22-10-7-16(13-20(22)23(30)28(4-2)24(27)31)12-18(29)6-5-11-32-19-9-8-17(15-26)21(25)14-19/h7-10,13-14H,3-6,11-12H2,1-2H3 |
| InChIKey | DCIHDSYOPMIODD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|