C21H22N2O3 — CID 7981141
[(2S)-1-[(9-ethylcarbazol-3-yl)amino]-1-oxopropan-2-yl] (E)-but-2-enoate (PubChem CID 7981141) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is [(2S)-1-[(9-ethylcarbazol-3-yl)amino]-1-oxopropan-2-yl] (E)-but-2-enoate.
| Compound Name | [(2S)-1-[(9-ethylcarbazol-3-yl)amino]-1-oxopropan-2-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 7981141 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [(2S)-1-[(9-ethylcarbazol-3-yl)amino]-1-oxopropan-2-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@@H](C)C(=O)Nc1ccc2c(c1)c1ccccc1n2CC |
| InChI | InChI=1S/C21H22N2O3/c1-4-8-20(24)26-14(3)21(25)22-15-11-12-19-17(13-15)16-9-6-7-10-18(16)23(19)5-2/h4,6-14H,5H2,1-3H3,(H,22,25)/b8-4+/t14-/m0/s1 |
| InChIKey | PTCWUSNJOXHUPM-PXYYCUNGSA-N |
| XLogP | 4.26 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|