C24H24N2O2 — CID 1019882
(2R)-N-(9-ethylcarbazol-3-yl)-2-(4-methylphenoxy)propanamide (PubChem CID 1019882) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (2R)-N-(9-ethylcarbazol-3-yl)-2-(4-methylphenoxy)propanamide.
| Compound Name | (2R)-N-(9-ethylcarbazol-3-yl)-2-(4-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 1019882 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (2R)-N-(9-ethylcarbazol-3-yl)-2-(4-methylphenoxy)propanamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)[C@@H](C)Oc3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C24H24N2O2/c1-4-26-22-8-6-5-7-20(22)21-15-18(11-14-23(21)26)25-24(27)17(3)28-19-12-9-16(2)10-13-19/h5-15,17H,4H2,1-3H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | GRZYXAPIWJPJAM-QGZVFWFLSA-N |
| XLogP | 5.53 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |