C24H23FN2O2 — CID 17166239
N-(9-ethylcarbazol-3-yl)-2-(4-fluorophenoxy)butanamide (PubChem CID 17166239) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is N-(9-ethylcarbazol-3-yl)-2-(4-fluorophenoxy)butanamide.
| Compound Name | N-(9-ethylcarbazol-3-yl)-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 17166239 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-(9-ethylcarbazol-3-yl)-2-(4-fluorophenoxy)butanamide |
| SMILES | CCC(Oc1ccc(F)cc1)C(=O)Nc1ccc2c(c1)c1ccccc1n2CC |
| InChI | InChI=1S/C24H23FN2O2/c1-3-23(29-18-12-9-16(25)10-13-18)24(28)26-17-11-14-22-20(15-17)19-7-5-6-8-21(19)27(22)4-2/h5-15,23H,3-4H2,1-2H3,(H,26,28) |
| InChIKey | RNYMZMBDQXDXRS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |