C26H28N2O2 — CID 28988595
(2S)-2-(3,5-dimethylphenoxy)-N-(9-ethylcarbazol-3-yl)butanamide (PubChem CID 28988595) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethylphenoxy)-N-(9-ethylcarbazol-3-yl)butanamide.
| Compound Name | (2S)-2-(3,5-dimethylphenoxy)-N-(9-ethylcarbazol-3-yl)butanamide |
|---|---|
| PubChem CID | 28988595 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (2S)-2-(3,5-dimethylphenoxy)-N-(9-ethylcarbazol-3-yl)butanamide |
| SMILES | CC[C@H](Oc1cc(C)cc(C)c1)C(=O)Nc1ccc2c(c1)c1ccccc1n2CC |
| InChI | InChI=1S/C26H28N2O2/c1-5-25(30-20-14-17(3)13-18(4)15-20)26(29)27-19-11-12-24-22(16-19)21-9-7-8-10-23(21)28(24)6-2/h7-16,25H,5-6H2,1-4H3,(H,27,29)/t25-/m0/s1 |
| InChIKey | PYJAPCHBSPBPFS-VWLOTQADSA-N |
| XLogP | 6.23 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |