C11H7BrF3NO2 — CID 172674755
6-bromo-1-(2,2,2-trifluoroethyl)indole-3-carboxylic acid (PubChem CID 172674755) has the molecular formula C11H7BrF3NO2 and a molecular weight of 322.08 g/mol. Its IUPAC name is 6-bromo-1-(2,2,2-trifluoroethyl)indole-3-carboxylic acid.
| Compound Name | 6-bromo-1-(2,2,2-trifluoroethyl)indole-3-carboxylic acid |
|---|---|
| PubChem CID | 172674755 |
| Molecular Formula | C11H7BrF3NO2 |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 6-bromo-1-(2,2,2-trifluoroethyl)indole-3-carboxylic acid |
| SMILES | O=C(O)c1cn(CC(F)(F)F)c2cc(Br)ccc12 |
| InChI | InChI=1S/C11H7BrF3NO2/c12-6-1-2-7-8(10(17)18)4-16(9(7)3-6)5-11(13,14)15/h1-4H,5H2,(H,17,18) |
| InChIKey | HRBYAQIWASONJZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |