C14H17BrF3N3O2S — CID 166911695
6-bromo-3-[2-(dimethylsulfamoylamino)ethyl]-1-(2,2,2-trifluoroethyl)indole (PubChem CID 166911695) has the molecular formula C14H17BrF3N3O2S and a molecular weight of 428.27 g/mol. Its IUPAC name is 6-bromo-3-[2-(dimethylsulfamoylamino)ethyl]-1-(2,2,2-trifluoroethyl)indole.
| Compound Name | 6-bromo-3-[2-(dimethylsulfamoylamino)ethyl]-1-(2,2,2-trifluoroethyl)indole |
|---|---|
| PubChem CID | 166911695 |
| Molecular Formula | C14H17BrF3N3O2S |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 6-bromo-3-[2-(dimethylsulfamoylamino)ethyl]-1-(2,2,2-trifluoroethyl)indole |
| SMILES | CN(C)S(=O)(=O)NCCc1cn(CC(F)(F)F)c2cc(Br)ccc12 |
| InChI | InChI=1S/C14H17BrF3N3O2S/c1-20(2)24(22,23)19-6-5-10-8-21(9-14(16,17)18)13-7-11(15)3-4-12(10)13/h3-4,7-8,19H,5-6,9H2,1-2H3 |
| InChIKey | WBSZKCSQMNXOEE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |