C23H31N3O3S — CID 166911189
3-[2-(dimethylsulfamoylamino)ethyl]-6-(2-methoxyphenyl)-1-(2-methylpropyl)indole (PubChem CID 166911189) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 3-[2-(dimethylsulfamoylamino)ethyl]-6-(2-methoxyphenyl)-1-(2-methylpropyl)indole.
| Compound Name | 3-[2-(dimethylsulfamoylamino)ethyl]-6-(2-methoxyphenyl)-1-(2-methylpropyl)indole |
|---|---|
| PubChem CID | 166911189 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 3-[2-(dimethylsulfamoylamino)ethyl]-6-(2-methoxyphenyl)-1-(2-methylpropyl)indole |
| SMILES | COc1ccccc1-c1ccc2c(CCNS(=O)(=O)N(C)C)cn(CC(C)C)c2c1 |
| InChI | InChI=1S/C23H31N3O3S/c1-17(2)15-26-16-19(12-13-24-30(27,28)25(3)4)20-11-10-18(14-22(20)26)21-8-6-7-9-23(21)29-5/h6-11,14,16-17,24H,12-13,15H2,1-5H3 |
| InChIKey | SAHIIYIZTWPWHE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |