C20H33N3O2S — CID 166910693
6-tert-butyl-3-[2-(dimethylsulfamoylamino)ethyl]-1-(2-methylpropyl)indole (PubChem CID 166910693) has the molecular formula C20H33N3O2S and a molecular weight of 379.57 g/mol. Its IUPAC name is 6-tert-butyl-3-[2-(dimethylsulfamoylamino)ethyl]-1-(2-methylpropyl)indole.
| Compound Name | 6-tert-butyl-3-[2-(dimethylsulfamoylamino)ethyl]-1-(2-methylpropyl)indole |
|---|---|
| PubChem CID | 166910693 |
| Molecular Formula | C20H33N3O2S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 6-tert-butyl-3-[2-(dimethylsulfamoylamino)ethyl]-1-(2-methylpropyl)indole |
| SMILES | CC(C)Cn1cc(CCNS(=O)(=O)N(C)C)c2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C20H33N3O2S/c1-15(2)13-23-14-16(10-11-21-26(24,25)22(6)7)18-9-8-17(12-19(18)23)20(3,4)5/h8-9,12,14-15,21H,10-11,13H2,1-7H3 |
| InChIKey | WAHLHCCNJKGPSN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |