C18H28BrN3O3S — CID 166910904
6-bromo-3-[2-(dimethylsulfamoylamino)ethyl]-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]indole (PubChem CID 166910904) has the molecular formula C18H28BrN3O3S and a molecular weight of 446.41 g/mol. Its IUPAC name is 6-bromo-3-[2-(dimethylsulfamoylamino)ethyl]-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]indole.
| Compound Name | 6-bromo-3-[2-(dimethylsulfamoylamino)ethyl]-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]indole |
|---|---|
| PubChem CID | 166910904 |
| Molecular Formula | C18H28BrN3O3S |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 6-bromo-3-[2-(dimethylsulfamoylamino)ethyl]-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]indole |
| SMILES | CN(C)S(=O)(=O)NCCc1cn(CCOC(C)(C)C)c2cc(Br)ccc12 |
| InChI | InChI=1S/C18H28BrN3O3S/c1-18(2,3)25-11-10-22-13-14(8-9-20-26(23,24)21(4)5)16-7-6-15(19)12-17(16)22/h6-7,12-13,20H,8-11H2,1-5H3 |
| InChIKey | WYHCZYTYNKBYQM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |