C23H31N3OS — CID 166912168
N-(dimethylaminosulfanyl)-2-[6-(3-methoxyphenyl)-1-(2-methylpropyl)indol-3-yl]ethanamine (PubChem CID 166912168) has the molecular formula C23H31N3OS and a molecular weight of 397.59 g/mol. Its IUPAC name is N-(dimethylaminosulfanyl)-2-[6-(3-methoxyphenyl)-1-(2-methylpropyl)indol-3-yl]ethanamine.
| Compound Name | N-(dimethylaminosulfanyl)-2-[6-(3-methoxyphenyl)-1-(2-methylpropyl)indol-3-yl]ethanamine |
|---|---|
| PubChem CID | 166912168 |
| Molecular Formula | C23H31N3OS |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-(dimethylaminosulfanyl)-2-[6-(3-methoxyphenyl)-1-(2-methylpropyl)indol-3-yl]ethanamine |
| SMILES | COc1cccc(-c2ccc3c(CCNSN(C)C)cn(CC(C)C)c3c2)c1 |
| InChI | InChI=1S/C23H31N3OS/c1-17(2)15-26-16-20(11-12-24-28-25(3)4)22-10-9-19(14-23(22)26)18-7-6-8-21(13-18)27-5/h6-10,13-14,16-17,24H,11-12,15H2,1-5H3 |
| InChIKey | BCAUASOFTJTDPL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|