C14H11BrF3NO3 — CID 166911328
methyl 2-[6-bromo-1-(3,3,3-trifluoropropyl)indol-3-yl]-2-oxoacetate (PubChem CID 166911328) has the molecular formula C14H11BrF3NO3 and a molecular weight of 378.14 g/mol. Its IUPAC name is methyl 2-[6-bromo-1-(3,3,3-trifluoropropyl)indol-3-yl]-2-oxoacetate.
| Compound Name | methyl 2-[6-bromo-1-(3,3,3-trifluoropropyl)indol-3-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 166911328 |
| Molecular Formula | C14H11BrF3NO3 |
| Molecular Weight | 378.14 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | methyl 2-[6-bromo-1-(3,3,3-trifluoropropyl)indol-3-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1cn(CCC(F)(F)F)c2cc(Br)ccc12 |
| InChI | InChI=1S/C14H11BrF3NO3/c1-22-13(21)12(20)10-7-19(5-4-14(16,17)18)11-6-8(15)2-3-9(10)11/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | FRNVLYLKJWUXSW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.14 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|