C17H21NO4 — CID 143393503
methyl 2-oxo-2-[1-(3-propoxypropyl)indol-3-yl]acetate (PubChem CID 143393503) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 2-oxo-2-[1-(3-propoxypropyl)indol-3-yl]acetate.
| Compound Name | methyl 2-oxo-2-[1-(3-propoxypropyl)indol-3-yl]acetate |
|---|---|
| PubChem CID | 143393503 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl 2-oxo-2-[1-(3-propoxypropyl)indol-3-yl]acetate |
| SMILES | CCCOCCCn1cc(C(=O)C(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C17H21NO4/c1-3-10-22-11-6-9-18-12-14(16(19)17(20)21-2)13-7-4-5-8-15(13)18/h4-5,7-8,12H,3,6,9-11H2,1-2H3 |
| InChIKey | YCQOUWWOZAMIOQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|