C38H55BrN2O8Si2 — CID 159279518
2-bromoethoxy-tert-butyl-dimethylsilane;methyl 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]indol-3-yl]-2-oxoacetate;methyl 2-(1H-indol-3-yl)-2-oxoacetate (PubChem CID 159279518) has the molecular formula C38H55BrN2O8Si2 and a molecular weight of 803.94 g/mol. Its IUPAC name is 2-bromoethoxy-tert-butyl-dimethylsilane;methyl 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]indol-3-yl]-2-oxoacetate;methyl 2-(1H-indol-3-yl)-2-oxoacetate.
| Compound Name | 2-bromoethoxy-tert-butyl-dimethylsilane;methyl 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]indol-3-yl]-2-oxoacetate;methyl 2-(1H-indol-3-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 159279518 |
| Molecular Formula | C38H55BrN2O8Si2 |
| Molecular Weight | 803.94 g/mol |
| Exact Mass | 802.27 |
| IUPAC Name | 2-bromoethoxy-tert-butyl-dimethylsilane;methyl 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]indol-3-yl]-2-oxoacetate;methyl 2-(1H-indol-3-yl)-2-oxoacetate |
| SMILES | CC(C)(C)[Si](C)(C)OCCBr.COC(=O)C(=O)c1c[nH]c2ccccc12.COC(=O)C(=O)c1cn(CCO[Si](C)(C)C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C19H27NO4Si.C11H9NO3.C8H19BrOSi/c1-19(2,3)25(5,6)24-12-11-20-13-15(17(21)18(22)23-4)14-9-7-8-10-16(14)20;1-15-11(14)10(13)8-6-12-9-5-3-2-4-7(8)9;1-8(2,3)11(4,5)10-7-6-9/h7-10,13H,11-12H2,1-6H3;2-6,12H,1H3;6-7H2,1-5H3 |
| InChIKey | KYSSPZJFGHASFQ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.94 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|