C19H16F3NO3 — CID 172674772
6-(3-ethoxyphenyl)-1-(2,2,2-trifluoroethyl)indole-3-carboxylic acid (PubChem CID 172674772) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is 6-(3-ethoxyphenyl)-1-(2,2,2-trifluoroethyl)indole-3-carboxylic acid.
| Compound Name | 6-(3-ethoxyphenyl)-1-(2,2,2-trifluoroethyl)indole-3-carboxylic acid |
|---|---|
| PubChem CID | 172674772 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 6-(3-ethoxyphenyl)-1-(2,2,2-trifluoroethyl)indole-3-carboxylic acid |
| SMILES | CCOc1cccc(-c2ccc3c(C(=O)O)cn(CC(F)(F)F)c3c2)c1 |
| InChI | InChI=1S/C19H16F3NO3/c1-2-26-14-5-3-4-12(8-14)13-6-7-15-16(18(24)25)10-23(17(15)9-13)11-19(20,21)22/h3-10H,2,11H2,1H3,(H,24,25) |
| InChIKey | DWUYOAVKUOJGPC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |