C19H15N3O3 — CID 46858720
methyl 2-[[2-(3-cyanoindol-1-yl)acetyl]amino]benzoate (PubChem CID 46858720) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is methyl 2-[[2-(3-cyanoindol-1-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(3-cyanoindol-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 46858720 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | methyl 2-[[2-(3-cyanoindol-1-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)Cn1cc(C#N)c2ccccc21 |
| InChI | InChI=1S/C19H15N3O3/c1-25-19(24)15-7-2-4-8-16(15)21-18(23)12-22-11-13(10-20)14-6-3-5-9-17(14)22/h2-9,11H,12H2,1H3,(H,21,23) |
| InChIKey | FQZXGOOZRNNBIH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |