C25H22N4O4 — CID 46553530
methyl 1-[2-oxo-2-[4-(phenylcarbamoylamino)anilino]ethyl]indole-3-carboxylate (PubChem CID 46553530) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is methyl 1-[2-oxo-2-[4-(phenylcarbamoylamino)anilino]ethyl]indole-3-carboxylate.
| Compound Name | methyl 1-[2-oxo-2-[4-(phenylcarbamoylamino)anilino]ethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 46553530 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | methyl 1-[2-oxo-2-[4-(phenylcarbamoylamino)anilino]ethyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)Nc2ccc(NC(=O)Nc3ccccc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H22N4O4/c1-33-24(31)21-15-29(22-10-6-5-9-20(21)22)16-23(30)26-18-11-13-19(14-12-18)28-25(32)27-17-7-3-2-4-8-17/h2-15H,16H2,1H3,(H,26,30)(H2,27,28,32) |
| InChIKey | KOMFCHCWTKCKJH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |