C23H19N3O4S — CID 29335276
methyl 1-[2-oxo-2-[3-(thiophene-2-carbonylamino)anilino]ethyl]indole-3-carboxylate (PubChem CID 29335276) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is methyl 1-[2-oxo-2-[3-(thiophene-2-carbonylamino)anilino]ethyl]indole-3-carboxylate.
| Compound Name | methyl 1-[2-oxo-2-[3-(thiophene-2-carbonylamino)anilino]ethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 29335276 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | methyl 1-[2-oxo-2-[3-(thiophene-2-carbonylamino)anilino]ethyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)Nc2cccc(NC(=O)c3cccs3)c2)c2ccccc12 |
| InChI | InChI=1S/C23H19N3O4S/c1-30-23(29)18-13-26(19-9-3-2-8-17(18)19)14-21(27)24-15-6-4-7-16(12-15)25-22(28)20-10-5-11-31-20/h2-13H,14H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | MUNJMUUQERXOQH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |