C21H14Cl2N2O2S — CID 4027629
N-(3,5-dichlorophenyl)-2-[3-(thiophene-2-carbonyl)indol-1-yl]acetamide (PubChem CID 4027629) has the molecular formula C21H14Cl2N2O2S and a molecular weight of 429.33 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[3-(thiophene-2-carbonyl)indol-1-yl]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[3-(thiophene-2-carbonyl)indol-1-yl]acetamide |
|---|---|
| PubChem CID | 4027629 |
| Molecular Formula | C21H14Cl2N2O2S |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[3-(thiophene-2-carbonyl)indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(C(=O)c2cccs2)c2ccccc21)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H14Cl2N2O2S/c22-13-8-14(23)10-15(9-13)24-20(26)12-25-11-17(16-4-1-2-5-18(16)25)21(27)19-6-3-7-28-19/h1-11H,12H2,(H,24,26) |
| InChIKey | WGONQEJSTIBNDF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |