C23H21N3O5 — CID 30804609
methyl 1-[2-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-2-oxoethyl]indole-3-carboxylate (PubChem CID 30804609) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is methyl 1-[2-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-2-oxoethyl]indole-3-carboxylate.
| Compound Name | methyl 1-[2-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-2-oxoethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 30804609 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | methyl 1-[2-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-2-oxoethyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)Nc2ccc(CN3C(=O)CCC3=O)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H21N3O5/c1-31-23(30)18-13-25(19-5-3-2-4-17(18)19)14-20(27)24-16-8-6-15(7-9-16)12-26-21(28)10-11-22(26)29/h2-9,13H,10-12,14H2,1H3,(H,24,27) |
| InChIKey | MBRNCMJMOUXEEE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|