C23H23N3O4 — CID 30875257
methyl 1-[2-oxo-2-[3-[(2-oxopyrrolidin-1-yl)methyl]anilino]ethyl]indole-3-carboxylate (PubChem CID 30875257) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl 1-[2-oxo-2-[3-[(2-oxopyrrolidin-1-yl)methyl]anilino]ethyl]indole-3-carboxylate.
| Compound Name | methyl 1-[2-oxo-2-[3-[(2-oxopyrrolidin-1-yl)methyl]anilino]ethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 30875257 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | methyl 1-[2-oxo-2-[3-[(2-oxopyrrolidin-1-yl)methyl]anilino]ethyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)Nc2cccc(CN3CCCC3=O)c2)c2ccccc12 |
| InChI | InChI=1S/C23H23N3O4/c1-30-23(29)19-14-26(20-9-3-2-8-18(19)20)15-21(27)24-17-7-4-6-16(12-17)13-25-11-5-10-22(25)28/h2-4,6-9,12,14H,5,10-11,13,15H2,1H3,(H,24,27) |
| InChIKey | SPDFEIPSMNYBOM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |