C24H27N3O6S — CID 34038418
methyl 1-[2-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl]indole-3-carboxylate (PubChem CID 34038418) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is methyl 1-[2-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl]indole-3-carboxylate.
| Compound Name | methyl 1-[2-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 34038418 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | methyl 1-[2-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl]indole-3-carboxylate |
| SMILES | CCOc1ccc(NC(=O)Cn2cc(C(=O)OC)c3ccccc32)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C24H27N3O6S/c1-3-33-21-11-10-17(14-22(21)34(30,31)27-12-6-7-13-27)25-23(28)16-26-15-19(24(29)32-2)18-8-4-5-9-20(18)26/h4-5,8-11,14-15H,3,6-7,12-13,16H2,1-2H3,(H,25,28) |
| InChIKey | VEAAJNRLRMDVOF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |