C25H21ClN2O5S — CID 20911257
methyl 2-[[2-[3-[(2-chlorophenyl)methylsulfonyl]indol-1-yl]acetyl]amino]benzoate (PubChem CID 20911257) has the molecular formula C25H21ClN2O5S and a molecular weight of 496.97 g/mol. Its IUPAC name is methyl 2-[[2-[3-[(2-chlorophenyl)methylsulfonyl]indol-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[3-[(2-chlorophenyl)methylsulfonyl]indol-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 20911257 |
| Molecular Formula | C25H21ClN2O5S |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | methyl 2-[[2-[3-[(2-chlorophenyl)methylsulfonyl]indol-1-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)Cn1cc(S(=O)(=O)Cc2ccccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C25H21ClN2O5S/c1-33-25(30)18-9-3-6-12-21(18)27-24(29)15-28-14-23(19-10-4-7-13-22(19)28)34(31,32)16-17-8-2-5-11-20(17)26/h2-14H,15-16H2,1H3,(H,27,29) |
| InChIKey | MUUUBTJWYXMBAM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |