C23H17ClF2N2O3S — CID 30292105
N-(4-chloro-2-fluorophenyl)-2-[3-[(2-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide (PubChem CID 30292105) has the molecular formula C23H17ClF2N2O3S and a molecular weight of 474.92 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[3-[(2-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[3-[(2-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 30292105 |
| Molecular Formula | C23H17ClF2N2O3S |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[3-[(2-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2ccccc2F)c2ccccc21)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C23H17ClF2N2O3S/c24-16-9-10-20(19(26)11-16)27-23(29)13-28-12-22(17-6-2-4-8-21(17)28)32(30,31)14-15-5-1-3-7-18(15)25/h1-12H,13-14H2,(H,27,29) |
| InChIKey | YYHKYZLNJHKGNS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |