C24H20Cl2N2O3S — CID 30292117
N-(2-chloro-4-methylphenyl)-2-[3-[(3-chlorophenyl)methylsulfonyl]indol-1-yl]acetamide (PubChem CID 30292117) has the molecular formula C24H20Cl2N2O3S and a molecular weight of 487.41 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-2-[3-[(3-chlorophenyl)methylsulfonyl]indol-1-yl]acetamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-2-[3-[(3-chlorophenyl)methylsulfonyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 30292117 |
| Molecular Formula | C24H20Cl2N2O3S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-2-[3-[(3-chlorophenyl)methylsulfonyl]indol-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2cc(S(=O)(=O)Cc3cccc(Cl)c3)c3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C24H20Cl2N2O3S/c1-16-9-10-21(20(26)11-16)27-24(29)14-28-13-23(19-7-2-3-8-22(19)28)32(30,31)15-17-5-4-6-18(25)12-17/h2-13H,14-15H2,1H3,(H,27,29) |
| InChIKey | MCXKRXVYNGJSHC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |