C25H23FN2O4S — CID 30292321
2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 30292321) has the molecular formula C25H23FN2O4S and a molecular weight of 466.53 g/mol. Its IUPAC name is 2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 30292321 |
| Molecular Formula | C25H23FN2O4S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)Cn1cc(S(=O)(=O)Cc2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C25H23FN2O4S/c1-17-10-11-23(32-2)21(12-17)27-25(29)15-28-14-24(20-8-3-4-9-22(20)28)33(30,31)16-18-6-5-7-19(26)13-18/h3-14H,15-16H2,1-2H3,(H,27,29) |
| InChIKey | QDCHCCJCGJXDGP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |