C25H24N2O5S — CID 12005987
2-(3-benzylsulfonylindol-1-yl)-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 12005987) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is 2-(3-benzylsulfonylindol-1-yl)-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(3-benzylsulfonylindol-1-yl)-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 12005987 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-(3-benzylsulfonylindol-1-yl)-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2cc(S(=O)(=O)Cc3ccccc3)c3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C25H24N2O5S/c1-31-19-12-13-21(23(14-19)32-2)26-25(28)16-27-15-24(20-10-6-7-11-22(20)27)33(29,30)17-18-8-4-3-5-9-18/h3-15H,16-17H2,1-2H3,(H,26,28) |
| InChIKey | GRAHFHBDNQKUIY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |