C21H23FN2O4S — CID 30560175
2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 30560175) has the molecular formula C21H23FN2O4S and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 30560175 |
| Molecular Formula | C21H23FN2O4S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)Cn1cc(S(=O)(=O)Cc2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C21H23FN2O4S/c1-28-11-5-10-23-21(25)14-24-13-20(18-8-2-3-9-19(18)24)29(26,27)15-16-6-4-7-17(22)12-16/h2-4,6-9,12-13H,5,10-11,14-15H2,1H3,(H,23,25) |
| InChIKey | USAXHCDOVDGQFJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|