C22H23FN2O4S — CID 43958313
2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 43958313) has the molecular formula C22H23FN2O4S and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 43958313 |
| Molecular Formula | C22H23FN2O4S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2cccc(F)c2)c2ccccc21)NCC1CCCO1 |
| InChI | InChI=1S/C22H23FN2O4S/c23-17-6-3-5-16(11-17)15-30(27,28)21-13-25(20-9-2-1-8-19(20)21)14-22(26)24-12-18-7-4-10-29-18/h1-3,5-6,8-9,11,13,18H,4,7,10,12,14-15H2,(H,24,26) |
| InChIKey | ADELTVRDXHRKQQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |