C14H18FNO4S — CID 94087831
2-[(3-fluorophenyl)methylsulfonyl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 94087831) has the molecular formula C14H18FNO4S and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methylsulfonyl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[(3-fluorophenyl)methylsulfonyl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 94087831 |
| Molecular Formula | C14H18FNO4S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[(3-fluorophenyl)methylsulfonyl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(CS(=O)(=O)Cc1cccc(F)c1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C14H18FNO4S/c15-12-4-1-3-11(7-12)9-21(18,19)10-14(17)16-8-13-5-2-6-20-13/h1,3-4,7,13H,2,5-6,8-10H2,(H,16,17)/t13-/m1/s1 |
| InChIKey | CEORTNMQHFZSJQ-CYBMUJFWSA-N |
| XLogP | 1.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |