C9H18N2O4S — CID 82179993
2-(2-aminoethylsulfonyl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 82179993) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-(2-aminoethylsulfonyl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(2-aminoethylsulfonyl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 82179993 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-(2-aminoethylsulfonyl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | NCCS(=O)(=O)CC(=O)NCC1CCCO1 |
| InChI | InChI=1S/C9H18N2O4S/c10-3-5-16(13,14)7-9(12)11-6-8-2-1-4-15-8/h8H,1-7,10H2,(H,11,12) |
| InChIKey | BFNNOJFEDNIWNJ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |