C24H28N2O3S — CID 54589378
2-(3-benzylsulfonylindol-1-yl)-N-(cyclohexylmethyl)acetamide (PubChem CID 54589378) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-(3-benzylsulfonylindol-1-yl)-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-(3-benzylsulfonylindol-1-yl)-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 54589378 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-(3-benzylsulfonylindol-1-yl)-N-(cyclohexylmethyl)acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2ccccc2)c2ccccc21)NCC1CCCCC1 |
| InChI | InChI=1S/C24H28N2O3S/c27-24(25-15-19-9-3-1-4-10-19)17-26-16-23(21-13-7-8-14-22(21)26)30(28,29)18-20-11-5-2-6-12-20/h2,5-8,11-14,16,19H,1,3-4,9-10,15,17-18H2,(H,25,27) |
| InChIKey | IBZKQZSXLHFPQN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |