C21H21ClN2O4S — CID 16935785
2-[3-(4-chlorophenyl)sulfonylindol-1-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 16935785) has the molecular formula C21H21ClN2O4S and a molecular weight of 432.93 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)sulfonylindol-1-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)sulfonylindol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 16935785 |
| Molecular Formula | C21H21ClN2O4S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-[3-(4-chlorophenyl)sulfonylindol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)c2ccc(Cl)cc2)c2ccccc21)NCC1CCCO1 |
| InChI | InChI=1S/C21H21ClN2O4S/c22-15-7-9-17(10-8-15)29(26,27)20-13-24(19-6-2-1-5-18(19)20)14-21(25)23-12-16-4-3-11-28-16/h1-2,5-10,13,16H,3-4,11-12,14H2,(H,23,25) |
| InChIKey | IBFUIEVHALURLR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |