C22H23ClN2O3S — CID 16935724
1-(azepan-1-yl)-2-[3-(4-chlorophenyl)sulfonylindol-1-yl]ethanone (PubChem CID 16935724) has the molecular formula C22H23ClN2O3S and a molecular weight of 430.96 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[3-(4-chlorophenyl)sulfonylindol-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[3-(4-chlorophenyl)sulfonylindol-1-yl]ethanone |
|---|---|
| PubChem CID | 16935724 |
| Molecular Formula | C22H23ClN2O3S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 1-(azepan-1-yl)-2-[3-(4-chlorophenyl)sulfonylindol-1-yl]ethanone |
| SMILES | O=C(Cn1cc(S(=O)(=O)c2ccc(Cl)cc2)c2ccccc21)N1CCCCCC1 |
| InChI | InChI=1S/C22H23ClN2O3S/c23-17-9-11-18(12-10-17)29(27,28)21-15-25(20-8-4-3-7-19(20)21)16-22(26)24-13-5-1-2-6-14-24/h3-4,7-12,15H,1-2,5-6,13-14,16H2 |
| InChIKey | RFXVPTQJGFDCKB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |