C22H23FN2O3S — CID 16935925
2-[3-(4-fluorophenyl)sulfonylindol-1-yl]-1-(4-methylpiperidin-1-yl)ethanone (PubChem CID 16935925) has the molecular formula C22H23FN2O3S and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)sulfonylindol-1-yl]-1-(4-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[3-(4-fluorophenyl)sulfonylindol-1-yl]-1-(4-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 16935925 |
| Molecular Formula | C22H23FN2O3S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-[3-(4-fluorophenyl)sulfonylindol-1-yl]-1-(4-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCN(C(=O)Cn2cc(S(=O)(=O)c3ccc(F)cc3)c3ccccc32)CC1 |
| InChI | InChI=1S/C22H23FN2O3S/c1-16-10-12-24(13-11-16)22(26)15-25-14-21(19-4-2-3-5-20(19)25)29(27,28)18-8-6-17(23)7-9-18/h2-9,14,16H,10-13,15H2,1H3 |
| InChIKey | RRMWKMYCFQAXSH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |