C26H23F2N3O3S — CID 16935942
1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[3-(4-fluorophenyl)sulfonylindol-1-yl]ethanone (PubChem CID 16935942) has the molecular formula C26H23F2N3O3S and a molecular weight of 495.55 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[3-(4-fluorophenyl)sulfonylindol-1-yl]ethanone.
| Compound Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[3-(4-fluorophenyl)sulfonylindol-1-yl]ethanone |
|---|---|
| PubChem CID | 16935942 |
| Molecular Formula | C26H23F2N3O3S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[3-(4-fluorophenyl)sulfonylindol-1-yl]ethanone |
| SMILES | O=C(Cn1cc(S(=O)(=O)c2ccc(F)cc2)c2ccccc21)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H23F2N3O3S/c27-19-9-11-20(12-10-19)35(33,34)25-17-31(23-7-3-1-5-21(23)25)18-26(32)30-15-13-29(14-16-30)24-8-4-2-6-22(24)28/h1-12,17H,13-16,18H2 |
| InChIKey | CPNFYVKVUNTEPZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |