C18H17FN2O3S — CID 16935905
2-[3-(4-fluorophenyl)sulfonylindol-1-yl]-N,N-dimethylacetamide (PubChem CID 16935905) has the molecular formula C18H17FN2O3S and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)sulfonylindol-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[3-(4-fluorophenyl)sulfonylindol-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 16935905 |
| Molecular Formula | C18H17FN2O3S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-[3-(4-fluorophenyl)sulfonylindol-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cn1cc(S(=O)(=O)c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H17FN2O3S/c1-20(2)18(22)12-21-11-17(15-5-3-4-6-16(15)21)25(23,24)14-9-7-13(19)8-10-14/h3-11H,12H2,1-2H3 |
| InChIKey | OFFVWEGQCSOCKP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |