C27H28N2O3S — CID 30292566
2-[3-[(3-methylphenyl)methylsulfonyl]indol-1-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 30292566) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-[3-[(3-methylphenyl)methylsulfonyl]indol-1-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[3-[(3-methylphenyl)methylsulfonyl]indol-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 30292566 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2-[3-[(3-methylphenyl)methylsulfonyl]indol-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | Cc1cccc(CS(=O)(=O)c2cn(CC(=O)Nc3ccc(C(C)C)cc3)c3ccccc23)c1 |
| InChI | InChI=1S/C27H28N2O3S/c1-19(2)22-11-13-23(14-12-22)28-27(30)17-29-16-26(24-9-4-5-10-25(24)29)33(31,32)18-21-8-6-7-20(3)15-21/h4-16,19H,17-18H2,1-3H3,(H,28,30) |
| InChIKey | SCJGDBAQCZZANI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |