C19H14F2N2 — CID 156507700
N-[5-(difluoromethyl)-3-pyridinyl]-1,1-diphenylmethanimine (PubChem CID 156507700) has the molecular formula C19H14F2N2 and a molecular weight of 308.33 g/mol. Its IUPAC name is N-[5-(difluoromethyl)-3-pyridinyl]-1,1-diphenylmethanimine.
| Compound Name | N-[5-(difluoromethyl)-3-pyridinyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 156507700 |
| Molecular Formula | C19H14F2N2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-[5-(difluoromethyl)-3-pyridinyl]-1,1-diphenylmethanimine |
| SMILES | FC(F)c1cncc(N=C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C19H14F2N2/c20-19(21)16-11-17(13-22-12-16)23-18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,19H |
| InChIKey | IZSCYJDEIIZFKD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|