C26H27F2N3O2 — CID 172594102
tert-butyl N-[1-[5-(benzhydrylideneamino)-3-pyridinyl]-3,3-difluoropropyl]carbamate (PubChem CID 172594102) has the molecular formula C26H27F2N3O2 and a molecular weight of 451.52 g/mol. Its IUPAC name is tert-butyl N-[1-[5-(benzhydrylideneamino)-3-pyridinyl]-3,3-difluoropropyl]carbamate.
| Compound Name | tert-butyl N-[1-[5-(benzhydrylideneamino)-3-pyridinyl]-3,3-difluoropropyl]carbamate |
|---|---|
| PubChem CID | 172594102 |
| Molecular Formula | C26H27F2N3O2 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | tert-butyl N-[1-[5-(benzhydrylideneamino)-3-pyridinyl]-3,3-difluoropropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC(F)F)c1cncc(N=C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H27F2N3O2/c1-26(2,3)33-25(32)31-22(15-23(27)28)20-14-21(17-29-16-20)30-24(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-14,16-17,22-23H,15H2,1-3H3,(H,31,32) |
| InChIKey | LGSSLDRNMVNGME-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|